C20H23N3O4 — CID 171336986
(1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-ethyl-N-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336986) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-ethyl-N-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-ethyl-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336986 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-ethyl-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCN(C)C(=O)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-23(2)20(24)17-12-5-4-11(8-12)16(17)19-21-18(22-27-19)13-6-7-14-15(9-13)26-10-25-14/h6-7,9,11-12,16-17H,3-5,8,10H2,1-2H3/t11-,12+,16+,17+/m1/s1 |
| InChIKey | AKSGUENPRDCDDF-YIFBXAAPSA-N |
| XLogP | 3.07 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |