C24H22ClN3O4 — CID 171337007
(1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-[(4-chlorophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171337007) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-[(4-chlorophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-[(4-chlorophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171337007 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (1S,2S,3S,4R)-3-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-N-[(4-chlorophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C24H22ClN3O4/c25-17-6-1-13(2-7-17)11-26-23(29)20-14-3-4-15(9-14)21(20)24-27-22(28-32-24)16-5-8-18-19(10-16)31-12-30-18/h1-2,5-8,10,14-15,20-21H,3-4,9,11-12H2,(H,26,29)/t14-,15+,20-,21-/m0/s1 |
| InChIKey | IVEFXTMJYCJITF-YQMDMEMYSA-N |
| XLogP | 4.56 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |