C19H22FN3O2 — CID 171337173
(1S,2S,3S,4R)-N-ethyl-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171337173) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is (1S,2S,3S,4R)-N-ethyl-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-N-ethyl-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171337173 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (1S,2S,3S,4R)-N-ethyl-3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCN(C)C(=O)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C19H22FN3O2/c1-3-23(2)19(24)16-13-5-4-12(10-13)15(16)18-21-17(22-25-18)11-6-8-14(20)9-7-11/h6-9,12-13,15-16H,3-5,10H2,1-2H3/t12-,13+,15+,16+/m1/s1 |
| InChIKey | DKACBXROLVEMCP-VRKREXBASA-N |
| XLogP | 3.48 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |