C19H23N3O3S — CID 171336924
(1S,2S,3S,4R)-N-(oxan-4-yl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171336924) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (1S,2S,3S,4R)-N-(oxan-4-yl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-N-(oxan-4-yl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171336924 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (1S,2S,3S,4R)-N-(oxan-4-yl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NC1CCOCC1)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C19H23N3O3S/c23-18(20-14-3-6-24-7-4-14)15-11-1-2-12(9-11)16(15)19-21-17(22-25-19)13-5-8-26-10-13/h5,8,10-12,14-16H,1-4,6-7,9H2,(H,20,23)/t11-,12+,15-,16-/m0/s1 |
| InChIKey | QQTYGFPWUXQUDS-VZAMPYOESA-N |
| XLogP | 3.22 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |