C21H33N9O5 — CID 171338655
[(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(tetrazol-1-yl)-1H-pyrazol-5-yl]methanone;formic acid (PubChem CID 171338655) has the molecular formula C21H33N9O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is [(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(tetrazol-1-yl)-1H-pyrazol-5-yl]methanone;formic acid.
| Compound Name | [(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(tetrazol-1-yl)-1H-pyrazol-5-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171338655 |
| Molecular Formula | C21H33N9O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | [(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-[3-(tetrazol-1-yl)-1H-pyrazol-5-yl]methanone;formic acid |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(C(=O)c3cc(-n4cnnn4)n[nH]3)C2)[C@@H]2CCCCN21.O=CO.O=CO |
| InChI | InChI=1S/C19H29N9O.2CH2O2/c1-25(2)11-17-14-7-13(16-5-3-4-6-27(16)17)9-26(10-14)19(29)15-8-18(22-21-15)28-12-20-23-24-28;2*2-1-3/h8,12-14,16-17H,3-7,9-11H2,1-2H3,(H,21,22);2*1H,(H,2,3)/t13-,14+,16+,17+;;/m1../s1 |
| InChIKey | IPVRERKVTNFXMC-GMQBPZJWSA-N |
| XLogP | -0.34 |
| TPSA | 173.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|