C24H25N3O6 — CID 171338931
1,3-benzodioxol-5-yl-[(2R,3S)-4-(1H-indole-2-carbonyl)-2,3-dimethylpiperazin-1-yl]methanone;formic acid (PubChem CID 171338931) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[(2R,3S)-4-(1H-indole-2-carbonyl)-2,3-dimethylpiperazin-1-yl]methanone;formic acid.
| Compound Name | 1,3-benzodioxol-5-yl-[(2R,3S)-4-(1H-indole-2-carbonyl)-2,3-dimethylpiperazin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 171338931 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[(2R,3S)-4-(1H-indole-2-carbonyl)-2,3-dimethylpiperazin-1-yl]methanone;formic acid |
| SMILES | C[C@@H]1[C@H](C)N(C(=O)c2cc3ccccc3[nH]2)CCN1C(=O)c1ccc2c(c1)OCO2.O=CO |
| InChI | InChI=1S/C23H23N3O4.CH2O2/c1-14-15(2)26(23(28)19-11-16-5-3-4-6-18(16)24-19)10-9-25(14)22(27)17-7-8-20-21(12-17)30-13-29-20;2-1-3/h3-8,11-12,14-15,24H,9-10,13H2,1-2H3;1H,(H,2,3)/t14-,15+;/m1./s1 |
| InChIKey | HTDJNCJNNHWHMS-LIOBNPLQSA-N |
| XLogP | 2.97 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|