C37H50F3NO2 — CID 171340814
2,2,2-trifluoroacetic acid;3,14,18-trimethyl-19-(6-methylheptan-2-yl)-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene (PubChem CID 171340814) has the molecular formula C37H50F3NO2 and a molecular weight of 597.81 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;3,14,18-trimethyl-19-(6-methylheptan-2-yl)-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene.
| Compound Name | 2,2,2-trifluoroacetic acid;3,14,18-trimethyl-19-(6-methylheptan-2-yl)-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 171340814 |
| Molecular Formula | C37H50F3NO2 |
| Molecular Weight | 597.81 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;3,14,18-trimethyl-19-(6-methylheptan-2-yl)-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene |
| SMILES | Cc1c2c(nc3ccccc13)CCC1(C)C2=CCC2C1CCC1(C)C(C(C)CCCC(C)C)CCC21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C35H49N.C2HF3O2/c1-22(2)10-9-11-23(3)27-16-17-28-26-14-15-30-33-24(4)25-12-7-8-13-31(25)36-32(33)19-21-35(30,6)29(26)18-20-34(27,28)5;3-2(4,5)1(6)7/h7-8,12-13,15,22-23,26-29H,9-11,14,16-21H2,1-6H3;(H,6,7) |
| InChIKey | INKNITLKUXBBAL-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.81 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |