C20H22NO5P — CID 171341392
(4R)-4-(4-diethoxyphosphorylphenyl)-4-methyl-2-phenyl-1,3-oxazol-5-one (PubChem CID 171341392) has the molecular formula C20H22NO5P and a molecular weight of 387.37 g/mol. Its IUPAC name is (4R)-4-(4-diethoxyphosphorylphenyl)-4-methyl-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-(4-diethoxyphosphorylphenyl)-4-methyl-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 171341392 |
| Molecular Formula | C20H22NO5P |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (4R)-4-(4-diethoxyphosphorylphenyl)-4-methyl-2-phenyl-1,3-oxazol-5-one |
| SMILES | CCOP(=O)(OCC)c1ccc([C@@]2(C)N=C(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C20H22NO5P/c1-4-24-27(23,25-5-2)17-13-11-16(12-14-17)20(3)19(22)26-18(21-20)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3/t20-/m1/s1 |
| InChIKey | QZDWBVVSJOUJEZ-HXUWFJFHSA-N |
| XLogP | 3.80 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|