C33H36Cl2N4O7 — CID 171344516
[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[4-(3,4-dichloroanilino)quinazolin-5-yl]amino]-4-oxobutanoate (PubChem CID 171344516) has the molecular formula C33H36Cl2N4O7 and a molecular weight of 671.58 g/mol. Its IUPAC name is [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[4-(3,4-dichloroanilino)quinazolin-5-yl]amino]-4-oxobutanoate.
| Compound Name | [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[4-(3,4-dichloroanilino)quinazolin-5-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 171344516 |
| Molecular Formula | C33H36Cl2N4O7 |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 670.20 |
| IUPAC Name | [(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-[[4-(3,4-dichloroanilino)quinazolin-5-yl]amino]-4-oxobutanoate |
| SMILES | C[C@H]1[C@@H](OC(=O)CCC(=O)Nc2cccc3ncnc(Nc4ccc(Cl)c(Cl)c4)c23)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C33H36Cl2N4O7/c1-17-7-9-21-18(2)30(43-31-33(21)20(17)13-14-32(3,44-31)45-46-33)42-27(41)12-11-26(40)39-25-6-4-5-24-28(25)29(37-16-36-24)38-19-8-10-22(34)23(35)15-19/h4-6,8,10,15-18,20-21,30-31H,7,9,11-14H2,1-3H3,(H,39,40)(H,36,37,38)/t17-,18-,20+,21+,30+,31-,32+,33-/m1/s1 |
| InChIKey | VROGZVNDUXCTIG-QXLLPFCYSA-N |
| XLogP | 7.15 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|