C32H39N3O8 — CID 171346619
dibenzyl (2S,3R)-1-[(2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]aziridine-2-carbonyl]aziridine-2,3-dicarboxylate (PubChem CID 171346619) has the molecular formula C32H39N3O8 and a molecular weight of 593.68 g/mol. Its IUPAC name is dibenzyl (2S,3R)-1-[(2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]aziridine-2-carbonyl]aziridine-2,3-dicarboxylate.
| Compound Name | dibenzyl (2S,3R)-1-[(2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]aziridine-2-carbonyl]aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 171346619 |
| Molecular Formula | C32H39N3O8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | dibenzyl (2S,3R)-1-[(2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]aziridine-2-carbonyl]aziridine-2,3-dicarboxylate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H]1C(=O)N1[C@H](C(=O)OCc2ccccc2)[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H39N3O8/c1-20(2)16-23(33-31(40)43-32(3,4)5)27(36)34-17-24(34)28(37)35-25(29(38)41-18-21-12-8-6-9-13-21)26(35)30(39)42-19-22-14-10-7-11-15-22/h6-15,20,23-26H,16-19H2,1-5H3,(H,33,40)/t23-,24-,25-,26+,34?,35?/m0/s1 |
| InChIKey | KEMMYXYZFDGSMT-NGEBXWNVSA-N |
| XLogP | 3.20 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|