C8H8AsNO3S2 — CID 171348259
4-(1,3,2-dithiarsolan-2-yl)-2-nitrophenol (PubChem CID 171348259) has the molecular formula C8H8AsNO3S2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-(1,3,2-dithiarsolan-2-yl)-2-nitrophenol.
| Compound Name | 4-(1,3,2-dithiarsolan-2-yl)-2-nitrophenol |
|---|---|
| PubChem CID | 171348259 |
| Molecular Formula | C8H8AsNO3S2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.92 |
| IUPAC Name | 4-(1,3,2-dithiarsolan-2-yl)-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc([As]2SCCS2)ccc1O |
| InChI | InChI=1S/C8H8AsNO3S2/c11-8-2-1-6(5-7(8)10(12)13)9-14-3-4-15-9/h1-2,5,11H,3-4H2 |
| InChIKey | NYDFPGHKEYPDHC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|