C22H33IN2O5S — CID 171348430
2-hydroxyethyl-[6-[(2-iodo-3-pyridinyl)oxy]hexyl]-dimethylazanium;4-methylbenzenesulfonate (PubChem CID 171348430) has the molecular formula C22H33IN2O5S and a molecular weight of 564.49 g/mol. Its IUPAC name is 2-hydroxyethyl-[6-[(2-iodo-3-pyridinyl)oxy]hexyl]-dimethylazanium;4-methylbenzenesulfonate.
| Compound Name | 2-hydroxyethyl-[6-[(2-iodo-3-pyridinyl)oxy]hexyl]-dimethylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171348430 |
| Molecular Formula | C22H33IN2O5S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 2-hydroxyethyl-[6-[(2-iodo-3-pyridinyl)oxy]hexyl]-dimethylazanium;4-methylbenzenesulfonate |
| SMILES | C[N+](C)(CCO)CCCCCCOc1cccnc1I.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H26IN2O2.C7H8O3S/c1-18(2,11-12-19)10-5-3-4-6-13-20-14-8-7-9-17-15(14)16;1-6-2-4-7(5-3-6)11(8,9)10/h7-9,19H,3-6,10-13H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | FTEAYMKDTPKAJU-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|