C20H28INO5S — CID 162324453
2-hydroxyethyl-[2-(3-iodo-4-methoxyphenyl)ethyl]-dimethylazanium;4-methylbenzenesulfonate (PubChem CID 162324453) has the molecular formula C20H28INO5S and a molecular weight of 521.42 g/mol. Its IUPAC name is 2-hydroxyethyl-[2-(3-iodo-4-methoxyphenyl)ethyl]-dimethylazanium;4-methylbenzenesulfonate.
| Compound Name | 2-hydroxyethyl-[2-(3-iodo-4-methoxyphenyl)ethyl]-dimethylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162324453 |
| Molecular Formula | C20H28INO5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 2-hydroxyethyl-[2-(3-iodo-4-methoxyphenyl)ethyl]-dimethylazanium;4-methylbenzenesulfonate |
| SMILES | COc1ccc(CC[N+](C)(C)CCO)cc1I.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H21INO2.C7H8O3S/c1-15(2,8-9-16)7-6-11-4-5-13(17-3)12(14)10-11;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,10,16H,6-9H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | DCMNYZVPEZKTJN-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|