C36H26N4O10S2 — CID 171348774
[3-[4-oxo-3-[[3-[[4-oxo-2-(3-sulfooxyphenyl)quinazolin-3-yl]methyl]phenyl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate (PubChem CID 171348774) has the molecular formula C36H26N4O10S2 and a molecular weight of 738.76 g/mol. Its IUPAC name is [3-[4-oxo-3-[[3-[[4-oxo-2-(3-sulfooxyphenyl)quinazolin-3-yl]methyl]phenyl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [3-[4-oxo-3-[[3-[[4-oxo-2-(3-sulfooxyphenyl)quinazolin-3-yl]methyl]phenyl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 171348774 |
| Molecular Formula | C36H26N4O10S2 |
| Molecular Weight | 738.76 g/mol |
| Exact Mass | 738.11 |
| IUPAC Name | [3-[4-oxo-3-[[3-[[4-oxo-2-(3-sulfooxyphenyl)quinazolin-3-yl]methyl]phenyl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
| SMILES | O=c1c2ccccc2nc(-c2cccc(OS(=O)(=O)O)c2)n1Cc1cccc(Cn2c(-c3cccc(OS(=O)(=O)O)c3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C36H26N4O10S2/c41-35-29-14-1-3-16-31(29)37-33(25-10-6-12-27(19-25)49-51(43,44)45)39(35)21-23-8-5-9-24(18-23)22-40-34(38-32-17-4-2-15-30(32)36(40)42)26-11-7-13-28(20-26)50-52(46,47)48/h1-20H,21-22H2,(H,43,44,45)(H,46,47,48) |
| InChIKey | QLZLSMQIONHUDI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|