C35H29N7O10S2 — CID 71601065
[4-[4-oxo-3-[[1-[4-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]butyl]triazol-4-yl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate (PubChem CID 71601065) has the molecular formula C35H29N7O10S2 and a molecular weight of 771.79 g/mol. Its IUPAC name is [4-[4-oxo-3-[[1-[4-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]butyl]triazol-4-yl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [4-[4-oxo-3-[[1-[4-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]butyl]triazol-4-yl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 71601065 |
| Molecular Formula | C35H29N7O10S2 |
| Molecular Weight | 771.79 g/mol |
| Exact Mass | 771.14 |
| IUPAC Name | [4-[4-oxo-3-[[1-[4-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]butyl]triazol-4-yl]methyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
| SMILES | O=c1c2ccccc2nc(-c2ccc(OS(=O)(=O)O)cc2)n1CCCCn1cc(Cn2c(-c3ccc(OS(=O)(=O)O)cc3)nc3ccccc3c2=O)nn1 |
| InChI | InChI=1S/C35H29N7O10S2/c43-34-28-7-1-3-9-30(28)36-32(23-11-15-26(16-12-23)51-53(45,46)47)41(34)20-6-5-19-40-21-25(38-39-40)22-42-33(37-31-10-4-2-8-29(31)35(42)44)24-13-17-27(18-14-24)52-54(48,49)50/h1-4,7-18,21H,5-6,19-20,22H2,(H,45,46,47)(H,48,49,50) |
| InChIKey | QDWGQASDBUMQEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 227.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|