C34H30N4O10S2 — CID 171345321
[4-[4-oxo-3-[6-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]hexyl]quinazolin-2-yl]phenyl] hydrogen sulfate (PubChem CID 171345321) has the molecular formula C34H30N4O10S2 and a molecular weight of 718.77 g/mol. Its IUPAC name is [4-[4-oxo-3-[6-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]hexyl]quinazolin-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [4-[4-oxo-3-[6-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]hexyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 171345321 |
| Molecular Formula | C34H30N4O10S2 |
| Molecular Weight | 718.77 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | [4-[4-oxo-3-[6-[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]hexyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
| SMILES | O=c1c2ccccc2nc(-c2ccc(OS(=O)(=O)O)cc2)n1CCCCCCn1c(-c2ccc(OS(=O)(=O)O)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C34H30N4O10S2/c39-33-27-9-3-5-11-29(27)35-31(23-13-17-25(18-14-23)47-49(41,42)43)37(33)21-7-1-2-8-22-38-32(36-30-12-6-4-10-28(30)34(38)40)24-15-19-26(20-16-24)48-50(44,45)46/h3-6,9-20H,1-2,7-8,21-22H2,(H,41,42,43)(H,44,45,46) |
| InChIKey | MJWSFMQQCFOHAB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|