C36H31N7O10S2 — CID 71601067
[4-[4-oxo-3-[5-[4-[[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]methyl]triazol-1-yl]pentyl]quinazolin-2-yl]phenyl] hydrogen sulfate (PubChem CID 71601067) has the molecular formula C36H31N7O10S2 and a molecular weight of 785.82 g/mol. Its IUPAC name is [4-[4-oxo-3-[5-[4-[[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]methyl]triazol-1-yl]pentyl]quinazolin-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [4-[4-oxo-3-[5-[4-[[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]methyl]triazol-1-yl]pentyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 71601067 |
| Molecular Formula | C36H31N7O10S2 |
| Molecular Weight | 785.82 g/mol |
| Exact Mass | 785.16 |
| IUPAC Name | [4-[4-oxo-3-[5-[4-[[4-oxo-2-(4-sulfooxyphenyl)quinazolin-3-yl]methyl]triazol-1-yl]pentyl]quinazolin-2-yl]phenyl] hydrogen sulfate |
| SMILES | O=c1c2ccccc2nc(-c2ccc(OS(=O)(=O)O)cc2)n1CCCCCn1cc(Cn2c(-c3ccc(OS(=O)(=O)O)cc3)nc3ccccc3c2=O)nn1 |
| InChI | InChI=1S/C36H31N7O10S2/c44-35-29-8-2-4-10-31(29)37-33(24-12-16-27(17-13-24)52-54(46,47)48)42(35)21-7-1-6-20-41-22-26(39-40-41)23-43-34(38-32-11-5-3-9-30(32)36(43)45)25-14-18-28(19-15-25)53-55(49,50)51/h2-5,8-19,22H,1,6-7,20-21,23H2,(H,46,47,48)(H,49,50,51) |
| InChIKey | SUJSKPRKWODNFZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 227.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|