C19H17Cl2N3 — CID 171350454
3-(3,5-dichlorophenyl)-7-pyrrolidin-1-ylquinolin-2-amine (PubChem CID 171350454) has the molecular formula C19H17Cl2N3 and a molecular weight of 358.27 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-7-pyrrolidin-1-ylquinolin-2-amine.
| Compound Name | 3-(3,5-dichlorophenyl)-7-pyrrolidin-1-ylquinolin-2-amine |
|---|---|
| PubChem CID | 171350454 |
| Molecular Formula | C19H17Cl2N3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-7-pyrrolidin-1-ylquinolin-2-amine |
| SMILES | Nc1nc2cc(N3CCCC3)ccc2cc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3/c20-14-7-13(8-15(21)10-14)17-9-12-3-4-16(24-5-1-2-6-24)11-18(12)23-19(17)22/h3-4,7-11H,1-2,5-6H2,(H2,22,23) |
| InChIKey | INFUMCSVKCISIW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |