C30H30O8 — CID 171353255
(9bS)-2-acetyl-3,7,9-trihydroxy-8,9b-dimethyl-6-[(E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoyl]dibenzofuran-1-one (PubChem CID 171353255) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is (9bS)-2-acetyl-3,7,9-trihydroxy-8,9b-dimethyl-6-[(E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoyl]dibenzofuran-1-one.
| Compound Name | (9bS)-2-acetyl-3,7,9-trihydroxy-8,9b-dimethyl-6-[(E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoyl]dibenzofuran-1-one |
|---|---|
| PubChem CID | 171353255 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (9bS)-2-acetyl-3,7,9-trihydroxy-8,9b-dimethyl-6-[(E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoyl]dibenzofuran-1-one |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(=O)/C=C/c4ccc(OCCC(C)C)cc4)c(O)c(C)c(O)c3[C@]2(C)C1=O |
| InChI | InChI=1S/C30H30O8/c1-15(2)12-13-37-19-9-6-18(7-10-19)8-11-20(32)24-26(34)16(3)27(35)25-28(24)38-22-14-21(33)23(17(4)31)29(36)30(22,25)5/h6-11,14-15,33-35H,12-13H2,1-5H3/b11-8+/t30-/m1/s1 |
| InChIKey | PURYFTOQEUKCOT-AGLOJYHOSA-N |
| XLogP | 5.25 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|