C22H26N4O2S — CID 171354302
(2S)-2-[1-(4-methylphenyl)ethylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid (PubChem CID 171354302) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is (2S)-2-[1-(4-methylphenyl)ethylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid.
| Compound Name | (2S)-2-[1-(4-methylphenyl)ethylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 171354302 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2S)-2-[1-(4-methylphenyl)ethylamino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
| SMILES | Cc1ccc(C(C)N[C@@H](CCCn2c(-c3ccccc3)n[nH]c2=S)C(=O)O)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-15-10-12-17(13-11-15)16(2)23-19(21(27)28)9-6-14-26-20(24-25-22(26)29)18-7-4-3-5-8-18/h3-5,7-8,10-13,16,19,23H,6,9,14H2,1-2H3,(H,25,29)(H,27,28)/t16?,19-/m0/s1 |
| InChIKey | QTAXDSQSMPBVIR-CVMIBEPCSA-N |
| XLogP | 4.50 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|