C34H28O4 — CID 171358240
4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1-methyl-9,10-dihydrophenanthren-3-yl)-8-methylphenanthrene-2,7-diol (PubChem CID 171358240) has the molecular formula C34H28O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1-methyl-9,10-dihydrophenanthren-3-yl)-8-methylphenanthrene-2,7-diol.
| Compound Name | 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1-methyl-9,10-dihydrophenanthren-3-yl)-8-methylphenanthrene-2,7-diol |
|---|---|
| PubChem CID | 171358240 |
| Molecular Formula | C34H28O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-ethenyl-1-(5-ethenyl-2,7-dihydroxy-1-methyl-9,10-dihydrophenanthren-3-yl)-8-methylphenanthrene-2,7-diol |
| SMILES | C=Cc1cc(O)cc2c1-c1cc(-c3c(O)cc(C=C)c4c3ccc3c(C)c(O)ccc34)c(O)c(C)c1CC2 |
| InChI | InChI=1S/C34H28O4/c1-5-19-13-22(35)14-21-7-8-24-18(4)34(38)28(16-27(24)31(19)21)33-26-10-9-23-17(3)29(36)12-11-25(23)32(26)20(6-2)15-30(33)37/h5-6,9-16,35-38H,1-2,7-8H2,3-4H3 |
| InChIKey | RRTIZVGMTLCLHU-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|