C20H23CaN7O8 — CID 171360707
calcium;(2S)-2-[[4-[(2-amino-5-formyl-4-oxo-3,4a,6,7-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate;hydrate (PubChem CID 171360707) has the molecular formula C20H23CaN7O8 and a molecular weight of 529.52 g/mol. Its IUPAC name is calcium;(2S)-2-[[4-[(2-amino-5-formyl-4-oxo-3,4a,6,7-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate;hydrate.
| Compound Name | calcium;(2S)-2-[[4-[(2-amino-5-formyl-4-oxo-3,4a,6,7-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate;hydrate |
|---|---|
| PubChem CID | 171360707 |
| Molecular Formula | C20H23CaN7O8 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | calcium;(2S)-2-[[4-[(2-amino-5-formyl-4-oxo-3,4a,6,7-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate;hydrate |
| SMILES | NC1=NC2=NCC(CNc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc3)N(C=O)C2C(=O)N1.O.[Ca+2] |
| InChI | InChI=1S/C20H23N7O7.Ca.H2O/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30;;/h1-4,9,12-13,15,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H3,21,23,25,26,32);;1H2/q;+2;/p-2/t12?,13-,15?;;/m0../s1 |
| InChIKey | HQUIHUYSOIILOV-LFYPHSHQSA-L |
| XLogP | -5.68 |
| TPSA | 253.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|