C19H28N2O — CID 171361858
(2-methylpiperidin-1-yl)-(4-methyl-3-piperidin-4-ylphenyl)methanone (PubChem CID 171361858) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-(4-methyl-3-piperidin-4-ylphenyl)methanone.
| Compound Name | (2-methylpiperidin-1-yl)-(4-methyl-3-piperidin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 171361858 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (2-methylpiperidin-1-yl)-(4-methyl-3-piperidin-4-ylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCCC2C)cc1C1CCNCC1 |
| InChI | InChI=1S/C19H28N2O/c1-14-6-7-17(13-18(14)16-8-10-20-11-9-16)19(22)21-12-4-3-5-15(21)2/h6-7,13,15-16,20H,3-5,8-12H2,1-2H3 |
| InChIKey | KIFATMQKGGQHDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |