C16H18F3NO — CID 171362003
[5-ethenyl-2-(trifluoromethyl)phenyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 171362003) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is [5-ethenyl-2-(trifluoromethyl)phenyl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [5-ethenyl-2-(trifluoromethyl)phenyl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 171362003 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [5-ethenyl-2-(trifluoromethyl)phenyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | C=Cc1ccc(C(F)(F)F)c(C(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C16H18F3NO/c1-3-12-6-7-14(16(17,18)19)13(9-12)15(21)20-8-4-5-11(2)10-20/h3,6-7,9,11H,1,4-5,8,10H2,2H3 |
| InChIKey | PLGOXBVJKWEVRL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |