C31H45N7O — CID 171362937
2-[2-[(E)-3-(dimethylamino)prop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 171362937) has the molecular formula C31H45N7O and a molecular weight of 531.75 g/mol. Its IUPAC name is 2-[2-[(E)-3-(dimethylamino)prop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | 2-[2-[(E)-3-(dimethylamino)prop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171362937 |
| Molecular Formula | C31H45N7O |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | 2-[2-[(E)-3-(dimethylamino)prop-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | CC1CCC2NNCC2C1c1c(C#N)c(N2CCC3(CN(C(=O)/C=C/N(C)C)C3)C2)nc2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C31H45N7O/c1-20-6-7-24-23(16-33-35-24)27(20)28-21-8-10-30(2,3)14-25(21)34-29(22(28)15-32)37-13-11-31(17-37)18-38(19-31)26(39)9-12-36(4)5/h9,12,20,23-24,27,33,35H,6-8,10-11,13-14,16-19H2,1-5H3/b12-9+ |
| InChIKey | LXMYODVUXYXCOB-FMIVXFBMSA-N |
| XLogP | 3.19 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|