C29H38N6O — CID 171362945
4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)spiro[7,8-dihydro-5H-quinoline-6,1'-cyclopropane]-3-carbonitrile (PubChem CID 171362945) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is 4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)spiro[7,8-dihydro-5H-quinoline-6,1'-cyclopropane]-3-carbonitrile.
| Compound Name | 4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)spiro[7,8-dihydro-5H-quinoline-6,1'-cyclopropane]-3-carbonitrile |
|---|---|
| PubChem CID | 171362945 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-(2-prop-2-enoyl-2,7-diazaspiro[3.4]octan-7-yl)spiro[7,8-dihydro-5H-quinoline-6,1'-cyclopropane]-3-carbonitrile |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(C5C(C)CCC6NNCC65)c3C#N)CC3(CC4)CC3)C2)C1 |
| InChI | InChI=1S/C29H38N6O/c1-3-24(36)35-16-29(17-35)10-11-34(15-29)27-20(13-30)26(19-12-28(8-9-28)7-6-22(19)32-27)25-18(2)4-5-23-21(25)14-31-33-23/h3,18,21,23,25,31,33H,1,4-12,14-17H2,2H3 |
| InChIKey | PSSPWEBSVFSLDH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|