C13H25NO2Si — CID 171365750
N-ethyl-2-[(1S,2S,5S)-2-(hydroxymethyl)-5-trimethylsilylcyclopent-3-en-1-yl]acetamide (PubChem CID 171365750) has the molecular formula C13H25NO2Si and a molecular weight of 255.43 g/mol. Its IUPAC name is N-ethyl-2-[(1S,2S,5S)-2-(hydroxymethyl)-5-trimethylsilylcyclopent-3-en-1-yl]acetamide.
| Compound Name | N-ethyl-2-[(1S,2S,5S)-2-(hydroxymethyl)-5-trimethylsilylcyclopent-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 171365750 |
| Molecular Formula | C13H25NO2Si |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-ethyl-2-[(1S,2S,5S)-2-(hydroxymethyl)-5-trimethylsilylcyclopent-3-en-1-yl]acetamide |
| SMILES | CCNC(=O)C[C@H]1[C@@H](CO)C=C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C13H25NO2Si/c1-5-14-13(16)8-11-10(9-15)6-7-12(11)17(2,3)4/h6-7,10-12,15H,5,8-9H2,1-4H3,(H,14,16)/t10-,11+,12+/m1/s1 |
| InChIKey | HRWXUHOBYYEYSQ-WOPDTQHZSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|