C24H23BrN4O — CID 171366922
5-(4-bromophenyl)-N-butyl-7-(2-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 171366922) has the molecular formula C24H23BrN4O and a molecular weight of 463.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-butyl-7-(2-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-bromophenyl)-N-butyl-7-(2-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171366922 |
| Molecular Formula | C24H23BrN4O |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 5-(4-bromophenyl)-N-butyl-7-(2-methoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1ncnc2nc(-c3ccccc3OC)cc(-c3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C24H23BrN4O/c1-3-4-13-26-23-22-19(16-9-11-17(25)12-10-16)14-20(29-24(22)28-15-27-23)18-7-5-6-8-21(18)30-2/h5-12,14-15H,3-4,13H2,1-2H3,(H,26,27,28,29) |
| InChIKey | QBDFBULMSQSJCY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|