C15H19BBrNO3S — CID 171371109
[3-(4-bromo-1,3-thiazol-5-yl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 171371109) has the molecular formula C15H19BBrNO3S and a molecular weight of 384.10 g/mol. Its IUPAC name is [3-(4-bromo-1,3-thiazol-5-yl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [3-(4-bromo-1,3-thiazol-5-yl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 171371109 |
| Molecular Formula | C15H19BBrNO3S |
| Molecular Weight | 384.10 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | [3-(4-bromo-1,3-thiazol-5-yl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cccc(-c2scnc2Br)c1 |
| InChI | InChI=1S/C15H19BBrNO3S/c1-14(2,19)15(3,4)21-16(20)11-7-5-6-10(8-11)12-13(17)18-9-22-12/h5-9,19-20H,1-4H3 |
| InChIKey | ORGOWFPKPADLGP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.10 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|