C7H4IN3O — CID 171373689
2-(4-iodo-2-pyridinyl)-1,3,4-oxadiazole (PubChem CID 171373689) has the molecular formula C7H4IN3O and a molecular weight of 273.03 g/mol. Its IUPAC name is 2-(4-iodo-2-pyridinyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-iodo-2-pyridinyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 171373689 |
| Molecular Formula | C7H4IN3O |
| Molecular Weight | 273.03 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | 2-(4-iodo-2-pyridinyl)-1,3,4-oxadiazole |
| SMILES | Ic1ccnc(-c2nnco2)c1 |
| InChI | InChI=1S/C7H4IN3O/c8-5-1-2-9-6(3-5)7-11-10-4-12-7/h1-4H |
| InChIKey | GONXRAVTROHVMP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.03 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|