C14H22O2 — CID 171376429
6-[(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-4,4-dimethyl-2,3-dihydropyran (PubChem CID 171376429) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-[(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-4,4-dimethyl-2,3-dihydropyran.
| Compound Name | 6-[(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-4,4-dimethyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 171376429 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 6-[(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-4,4-dimethyl-2,3-dihydropyran |
| SMILES | C=C(C)/C=C(\OCC)C1=CC(C)(C)CCO1 |
| InChI | InChI=1S/C14H22O2/c1-6-15-12(9-11(2)3)13-10-14(4,5)7-8-16-13/h9-10H,2,6-8H2,1,3-5H3/b12-9- |
| InChIKey | FMUKUKGFNHYONW-XFXZXTDPSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|