C10H20GeO — CID 101385690
[(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-trimethylgermane (PubChem CID 101385690) has the molecular formula C10H20GeO and a molecular weight of 228.88 g/mol. Its IUPAC name is [(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-trimethylgermane.
| Compound Name | [(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-trimethylgermane |
|---|---|
| PubChem CID | 101385690 |
| Molecular Formula | C10H20GeO |
| Molecular Weight | 228.88 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(1Z)-1-ethoxy-3-methylbuta-1,3-dienyl]-trimethylgermane |
| SMILES | C=C(C)/C=C(/OCC)[Ge](C)(C)C |
| InChI | InChI=1S/C10H20GeO/c1-7-12-10(8-9(2)3)11(4,5)6/h8H,2,7H2,1,3-6H3/b10-8+ |
| InChIKey | AVFWVUYBHFUNES-CSKARUKUSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|