C10H25N3O7P2 — CID 171381055
3-aminopropyl 2-[2-hydroxyethyl-(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)amino]ethyl hydrogen phosphate (PubChem CID 171381055) has the molecular formula C10H25N3O7P2 and a molecular weight of 361.27 g/mol. Its IUPAC name is 3-aminopropyl 2-[2-hydroxyethyl-(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)amino]ethyl hydrogen phosphate.
| Compound Name | 3-aminopropyl 2-[2-hydroxyethyl-(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)amino]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 171381055 |
| Molecular Formula | C10H25N3O7P2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-aminopropyl 2-[2-hydroxyethyl-(2-oxo-1,3,2λ5-oxazaphosphinan-2-yl)amino]ethyl hydrogen phosphate |
| SMILES | NCCCOP(=O)(O)OCCN(CCO)P1(=O)NCCCO1 |
| InChI | InChI=1S/C10H25N3O7P2/c11-3-1-8-19-22(16,17)20-10-6-13(5-7-14)21(15)12-4-2-9-18-21/h14H,1-11H2,(H,12,15)(H,16,17) |
| InChIKey | UZQUTLRGUDBRDW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|