C18H43N2O7P — CID 174852561
2-aminoethyl 8-methylnonyl hydrogen phosphate;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 174852561) has the molecular formula C18H43N2O7P and a molecular weight of 430.52 g/mol. Its IUPAC name is 2-aminoethyl 8-methylnonyl hydrogen phosphate;2-[bis(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-aminoethyl 8-methylnonyl hydrogen phosphate;2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 174852561 |
| Molecular Formula | C18H43N2O7P |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 2-aminoethyl 8-methylnonyl hydrogen phosphate;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | CC(C)CCCCCCCOP(=O)(O)OCCN.OCCN(CCO)CCO |
| InChI | InChI=1S/C12H28NO4P.C6H15NO3/c1-12(2)8-6-4-3-5-7-10-16-18(14,15)17-11-9-13;8-4-1-7(2-5-9)3-6-10/h12H,3-11,13H2,1-2H3,(H,14,15);8-10H,1-6H2 |
| InChIKey | SDCJNGVBTXTBME-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|