C4H9NO2S — CID 171381617
(2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid (PubChem CID 171381617) has the molecular formula C4H9NO2S and a molecular weight of 139.21 g/mol. Its IUPAC name is (2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid.
| Compound Name | (2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 171381617 |
| Molecular Formula | C4H9NO2S |
| Molecular Weight | 139.21 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid |
| SMILES | [2H]C([2H])(S)C([2H])([2H])[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1/i1D2,2D2 |
| InChIKey | FFFHZYDWPBMWHY-ADHRGRJKSA-N |
| XLogP | -0.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|