C24H23NO8 — CID 171382125
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2,3,5,6-tetradeuterio-4-[(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 171382125) has the molecular formula C24H23NO8 and a molecular weight of 465.52 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2,3,5,6-tetradeuterio-4-[(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2,3,5,6-tetradeuterio-4-[(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171382125 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2,3,5,6-tetradeuterio-4-[(2,3,5,6-tetradeuterio-4-hydroxyphenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | [2H]c1nc(C(c2c([2H])c([2H])c(O)c([2H])c2[2H])c2c([2H])c([2H])c(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c([2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C24H23NO8/c26-15-8-4-13(5-9-15)18(17-3-1-2-12-25-17)14-6-10-16(11-7-14)32-24-21(29)19(27)20(28)22(33-24)23(30)31/h1-12,18-22,24,26-29H,(H,30,31)/t18?,19-,20-,21+,22-,24+/m0/s1/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | RRVPDCNRRXUDQK-BWTBSPKHSA-N |
| XLogP | 1.24 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |