C6H13N — CID 171383942
(2S,3S)-1-ethyl-2,3-dimethylaziridine (PubChem CID 171383942) has the molecular formula C6H13N and a molecular weight of 99.18 g/mol. Its IUPAC name is (2S,3S)-1-ethyl-2,3-dimethylaziridine.
| Compound Name | (2S,3S)-1-ethyl-2,3-dimethylaziridine |
|---|---|
| PubChem CID | 171383942 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | (2S,3S)-1-ethyl-2,3-dimethylaziridine |
| SMILES | CCN1[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C6H13N/c1-4-7-5(2)6(7)3/h5-6H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | LUNWJKXZDYXTDB-WDSKDSINSA-N |
| XLogP | 1.10 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|