C22H15FN2O4S — CID 171390327
N-[4-[(2E)-2-(5-fluoro-2-oxo-1H-indol-3-ylidene)acetyl]phenyl]benzenesulfonamide (PubChem CID 171390327) has the molecular formula C22H15FN2O4S and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[4-[(2E)-2-(5-fluoro-2-oxo-1H-indol-3-ylidene)acetyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[(2E)-2-(5-fluoro-2-oxo-1H-indol-3-ylidene)acetyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171390327 |
| Molecular Formula | C22H15FN2O4S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[4-[(2E)-2-(5-fluoro-2-oxo-1H-indol-3-ylidene)acetyl]phenyl]benzenesulfonamide |
| SMILES | O=C1Nc2ccc(F)cc2/C1=C\C(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15FN2O4S/c23-15-8-11-20-18(12-15)19(22(27)24-20)13-21(26)14-6-9-16(10-7-14)25-30(28,29)17-4-2-1-3-5-17/h1-13,25H,(H,24,27)/b19-13+ |
| InChIKey | AAPNTDZFSIOQSC-CPNJWEJPSA-N |
| XLogP | 3.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|