C23H27N2O3+ — CID 171390871
ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate (PubChem CID 171390871) has the molecular formula C23H27N2O3+ and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate.
| Compound Name | ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 171390871 |
| Molecular Formula | C23H27N2O3+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)CN(Cc2ccccc2)C=[N+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H27N2O3/c1-3-28-22(27)23(19(2)26)16-24(14-20-10-6-4-7-11-20)18-25(17-23)15-21-12-8-5-9-13-21/h4-13,18H,3,14-17H2,1-2H3/q+1 |
| InChIKey | SHLJXHCQRWZQTA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|