C25H40 — CID 171392404
(2S,4R,5R,11S,14S,15S)-4,11,15,18-tetramethyl-5-propan-2-ylpentacyclo[8.7.1.01,14.02,10.04,8]octadec-8-ene (PubChem CID 171392404) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (2S,4R,5R,11S,14S,15S)-4,11,15,18-tetramethyl-5-propan-2-ylpentacyclo[8.7.1.01,14.02,10.04,8]octadec-8-ene.
| Compound Name | (2S,4R,5R,11S,14S,15S)-4,11,15,18-tetramethyl-5-propan-2-ylpentacyclo[8.7.1.01,14.02,10.04,8]octadec-8-ene |
|---|---|
| PubChem CID | 171392404 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (2S,4R,5R,11S,14S,15S)-4,11,15,18-tetramethyl-5-propan-2-ylpentacyclo[8.7.1.01,14.02,10.04,8]octadec-8-ene |
| SMILES | CC(C)[C@H]1CCC2=CC34C(C)C5(CC[C@H](C)[C@@H]5CC[C@@H]3C)[C@@H]4C[C@@]21C |
| InChI | InChI=1S/C25H40/c1-15(2)20-10-8-19-13-25-17(4)7-9-21-16(3)11-12-24(21,18(25)5)22(25)14-23(19,20)6/h13,15-18,20-22H,7-12,14H2,1-6H3/t16-,17-,18?,20+,21-,22-,23-,24?,25?/m0/s1 |
| InChIKey | IMIQYCVARKPMEI-ZWCBYKRRSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|