C17H21F3 — CID 169282325
5-[(1R)-1,3-dimethyl-6-propan-2-ylcyclohex-2-en-1-yl]-1,2,3-trifluorobenzene (PubChem CID 169282325) has the molecular formula C17H21F3 and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-[(1R)-1,3-dimethyl-6-propan-2-ylcyclohex-2-en-1-yl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[(1R)-1,3-dimethyl-6-propan-2-ylcyclohex-2-en-1-yl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 169282325 |
| Molecular Formula | C17H21F3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-[(1R)-1,3-dimethyl-6-propan-2-ylcyclohex-2-en-1-yl]-1,2,3-trifluorobenzene |
| SMILES | CC1=C[C@](C)(c2cc(F)c(F)c(F)c2)C(C(C)C)CC1 |
| InChI | InChI=1S/C17H21F3/c1-10(2)13-6-5-11(3)9-17(13,4)12-7-14(18)16(20)15(19)8-12/h7-10,13H,5-6H2,1-4H3/t13?,17-/m1/s1 |
| InChIKey | VLTWHQVYBDVDAL-LRHAYUFXSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|