C13H14F3 — CID 59887565
CID 59887565 (PubChem CID 59887565) has the molecular formula C13H14F3 and a molecular weight of 227.25 g/mol.
| Compound Name | CID 59887565 |
|---|---|
| PubChem CID | 59887565 |
| Molecular Formula | C13H14F3 |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | — |
| SMILES | CC1CC[C](c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H14F3/c1-8-2-4-9(5-3-8)10-6-11(14)13(16)12(15)7-10/h6-8H,2-5H2,1H3 |
| InChIKey | KKEWYIFPYLFYJZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|