C14H19BrO — CID 24894603
(1R,8aR)-6-bromo-8a-methyl-1-propan-2-yl-1,2,3,8-tetrahydroazulen-5-one (PubChem CID 24894603) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is (1R,8aR)-6-bromo-8a-methyl-1-propan-2-yl-1,2,3,8-tetrahydroazulen-5-one.
| Compound Name | (1R,8aR)-6-bromo-8a-methyl-1-propan-2-yl-1,2,3,8-tetrahydroazulen-5-one |
|---|---|
| PubChem CID | 24894603 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (1R,8aR)-6-bromo-8a-methyl-1-propan-2-yl-1,2,3,8-tetrahydroazulen-5-one |
| SMILES | CC(C)[C@H]1CCC2=CC(=O)C(Br)=CC[C@@]21C |
| InChI | InChI=1S/C14H19BrO/c1-9(2)11-5-4-10-8-13(16)12(15)6-7-14(10,11)3/h6,8-9,11H,4-5,7H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | HWMLMCLWJJACAD-RISCZKNCSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|