C8H10BrNO — CID 123289464
5-amino-2-bromo-5-methylcyclohepta-2,6-dien-1-one (PubChem CID 123289464) has the molecular formula C8H10BrNO and a molecular weight of 216.08 g/mol. Its IUPAC name is 5-amino-2-bromo-5-methylcyclohepta-2,6-dien-1-one.
| Compound Name | 5-amino-2-bromo-5-methylcyclohepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 123289464 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-amino-2-bromo-5-methylcyclohepta-2,6-dien-1-one |
| SMILES | CC1(N)C=CC(=O)C(Br)=CC1 |
| InChI | InChI=1S/C8H10BrNO/c1-8(10)4-2-6(9)7(11)3-5-8/h2-3,5H,4,10H2,1H3 |
| InChIKey | PFYMSSUBWBRQRM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|