C13H24N2O — CID 139754139
1-N-(2-ethoxyethyl)-1-N-ethyl-4-methylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 139754139) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-N-(2-ethoxyethyl)-1-N-ethyl-4-methylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 1-N-(2-ethoxyethyl)-1-N-ethyl-4-methylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 139754139 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-N-(2-ethoxyethyl)-1-N-ethyl-4-methylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | CCOCCN(CC)C1=CCC(C)(N)C=C1 |
| InChI | InChI=1S/C13H24N2O/c1-4-15(10-11-16-5-2)12-6-8-13(3,14)9-7-12/h6-8H,4-5,9-11,14H2,1-3H3 |
| InChIKey | QYLMKTMRBCGNEK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|