C8H8BrNO3 — CID 23425145
2-[(1S)-3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide (PubChem CID 23425145) has the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. Its IUPAC name is 2-[(1S)-3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide.
| Compound Name | 2-[(1S)-3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 23425145 |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.06 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 2-[(1S)-3-bromo-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide |
| SMILES | NC(=O)C[C@]1(O)C=CC(=O)C(Br)=C1 |
| InChI | InChI=1S/C8H8BrNO3/c9-5-3-8(13,4-7(10)12)2-1-6(5)11/h1-3,13H,4H2,(H2,10,12)/t8-/m0/s1 |
| InChIKey | IKAYLXNAYBFVMC-QMMMGPOBSA-N |
| XLogP | 0.01 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.06 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|