C17H20F6N2 — CID 139941668
4-[2-(4-amino-4-methylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methylcyclohexa-2,4-dien-1-amine (PubChem CID 139941668) has the molecular formula C17H20F6N2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-[2-(4-amino-4-methylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-[2-(4-amino-4-methylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139941668 |
| Molecular Formula | C17H20F6N2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[2-(4-amino-4-methylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1(N)C=CC(C(C2=CCC(C)(N)C=C2)(C(F)(F)F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C17H20F6N2/c1-13(24)7-3-11(4-8-13)15(16(18,19)20,17(21,22)23)12-5-9-14(2,25)10-6-12/h3-7,9H,8,10,24-25H2,1-2H3 |
| InChIKey | AOFMTBROPQSNGR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |