C14H25NO6 — CID 171394589
(4S)-4-(2-methylpropyl)-1-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one (PubChem CID 171394589) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is (4S)-4-(2-methylpropyl)-1-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one.
| Compound Name | (4S)-4-(2-methylpropyl)-1-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171394589 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (4S)-4-(2-methylpropyl)-1-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl]pyrrolidin-2-one |
| SMILES | CC(C)C[C@H]1CC(=O)N(CC2(O)OC[C@@H](O)[C@@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C14H25NO6/c1-8(2)3-9-4-11(17)15(5-9)7-14(20)13(19)12(18)10(16)6-21-14/h8-10,12-13,16,18-20H,3-7H2,1-2H3/t9-,10+,12+,13-,14?/m0/s1 |
| InChIKey | AZUXUOROLIYZMA-WKYGICIJSA-N |
| XLogP | -1.32 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |