C6H11NO4 — CID 171396492
5-(2-hydroxyethyl)-1,2,5-dioxazepan-3-one (PubChem CID 171396492) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1,2,5-dioxazepan-3-one.
| Compound Name | 5-(2-hydroxyethyl)-1,2,5-dioxazepan-3-one |
|---|---|
| PubChem CID | 171396492 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 5-(2-hydroxyethyl)-1,2,5-dioxazepan-3-one |
| SMILES | O=C1CN(CCO)CCOO1 |
| InChI | InChI=1S/C6H11NO4/c8-3-1-7-2-4-10-11-6(9)5-7/h8H,1-5H2 |
| InChIKey | KDDOXCNATFSMKN-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|