C11H16N2O6 — CID 144946774
4-[2-(4-oxo-1,3,6-dioxazocan-6-yl)ethyl]morpholine-2,6-dione (PubChem CID 144946774) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[2-(4-oxo-1,3,6-dioxazocan-6-yl)ethyl]morpholine-2,6-dione.
| Compound Name | 4-[2-(4-oxo-1,3,6-dioxazocan-6-yl)ethyl]morpholine-2,6-dione |
|---|---|
| PubChem CID | 144946774 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[2-(4-oxo-1,3,6-dioxazocan-6-yl)ethyl]morpholine-2,6-dione |
| SMILES | O=C1CN(CCN2CC(=O)OC(=O)C2)CCOCO1 |
| InChI | InChI=1S/C11H16N2O6/c14-9-5-12(3-4-17-8-18-9)1-2-13-6-10(15)19-11(16)7-13/h1-8H2 |
| InChIKey | UHSYKHDUJSJQEJ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|